C36H30O21 — CID 73426490
3-(3,4-dihydroxy-5-methylbenzoyl)oxy-1,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid (PubChem CID 73426490) has the molecular formula C36H30O21 and a molecular weight of 798.61 g/mol. Its IUPAC name is 3-(3,4-dihydroxy-5-methylbenzoyl)oxy-1,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid.
| Compound Name | 3-(3,4-dihydroxy-5-methylbenzoyl)oxy-1,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 73426490 |
| Molecular Formula | C36H30O21 |
| Molecular Weight | 798.61 g/mol |
| Exact Mass | 798.13 |
| IUPAC Name | 3-(3,4-dihydroxy-5-methylbenzoyl)oxy-1,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(C(=O)OC2CC(OC(=O)c3cc(O)c(O)c(O)c3)(C(=O)O)CC(OC(=O)c3cc(O)c(O)c(O)c3)C2OC(=O)c2cc(O)c(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C36H30O21/c1-12-2-13(3-17(37)26(12)44)31(48)54-24-10-36(35(52)53,57-34(51)16-8-22(42)29(47)23(43)9-16)11-25(55-32(49)14-4-18(38)27(45)19(39)5-14)30(24)56-33(50)15-6-20(40)28(46)21(41)7-15/h2-9,24-25,30,37-47H,10-11H2,1H3,(H,52,53) |
| InChIKey | WNPIQMUYVWNNMV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 365.03 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|