C16H22N4O4 — CID 167817937
N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-propan-2-ylpyrimidine-5-carboxamide (PubChem CID 167817937) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-propan-2-ylpyrimidine-5-carboxamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-propan-2-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 167817937 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-propan-2-ylpyrimidine-5-carboxamide |
| SMILES | CC(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)c1cnc(C(C)C)nc1 |
| InChI | InChI=1S/C16H22N4O4/c1-8(2)15-17-4-10(5-18-15)16(22)20-12-7-24-13-11(19-9(3)21)6-23-14(12)13/h4-5,8,11-14H,6-7H2,1-3H3,(H,19,21)(H,20,22)/t11-,12-,13+,14+/m0/s1 |
| InChIKey | RNHFPJHJGFZHRX-IGQOVBAYSA-N |
| XLogP | 0.00 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |