C19H21N3O3S — CID 91779564
N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2-propyl-1,3-thiazole-4-carboxamide (PubChem CID 91779564) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2-propyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2-propyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91779564 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-2-propyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCc1nc(C(=O)N[C@@H]2CCOC[C@H]2Oc2ccc(C#N)cc2)cs1 |
| InChI | InChI=1S/C19H21N3O3S/c1-2-3-18-21-16(12-26-18)19(23)22-15-8-9-24-11-17(15)25-14-6-4-13(10-20)5-7-14/h4-7,12,15,17H,2-3,8-9,11H2,1H3,(H,22,23)/t15-,17-/m1/s1 |
| InChIKey | QBJHEUZIYDSCKN-NVXWUHKLSA-N |
| XLogP | 2.93 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |