C21H22N2O4 — CID 91777220
N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]-2-(3-methoxyphenyl)acetamide (PubChem CID 91777220) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 91777220 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[(3R,4R)-4-(4-cyanophenoxy)oxan-3-yl]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(CC(=O)N[C@@H]2COCC[C@H]2Oc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-25-18-4-2-3-16(11-18)12-21(24)23-19-14-26-10-9-20(19)27-17-7-5-15(13-22)6-8-17/h2-8,11,19-20H,9-10,12,14H2,1H3,(H,23,24)/t19-,20-/m1/s1 |
| InChIKey | PXFWBHXDIMRVTG-WOJBJXKFSA-N |
| XLogP | 2.46 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |