C15H20N2O7S — CID 91765912
4-[(3R,4R)-3-[[2-(methanesulfonamido)acetyl]amino]oxan-4-yl]oxybenzoic acid (PubChem CID 91765912) has the molecular formula C15H20N2O7S and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-[(3R,4R)-3-[[2-(methanesulfonamido)acetyl]amino]oxan-4-yl]oxybenzoic acid.
| Compound Name | 4-[(3R,4R)-3-[[2-(methanesulfonamido)acetyl]amino]oxan-4-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 91765912 |
| Molecular Formula | C15H20N2O7S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-[(3R,4R)-3-[[2-(methanesulfonamido)acetyl]amino]oxan-4-yl]oxybenzoic acid |
| SMILES | CS(=O)(=O)NCC(=O)N[C@@H]1COCC[C@H]1Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O7S/c1-25(21,22)16-8-14(18)17-12-9-23-7-6-13(12)24-11-4-2-10(3-5-11)15(19)20/h2-5,12-13,16H,6-9H2,1H3,(H,17,18)(H,19,20)/t12-,13-/m1/s1 |
| InChIKey | HFUJCGWWOJIHRM-CHWSQXEVSA-N |
| XLogP | -0.41 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |