C17H17FN2O4 — CID 91792650
4-[(3R,4R)-3-[(3-fluoro-4-pyridinyl)amino]oxan-4-yl]oxybenzoic acid (PubChem CID 91792650) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is 4-[(3R,4R)-3-[(3-fluoro-4-pyridinyl)amino]oxan-4-yl]oxybenzoic acid.
| Compound Name | 4-[(3R,4R)-3-[(3-fluoro-4-pyridinyl)amino]oxan-4-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 91792650 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[(3R,4R)-3-[(3-fluoro-4-pyridinyl)amino]oxan-4-yl]oxybenzoic acid |
| SMILES | O=C(O)c1ccc(O[C@@H]2CCOC[C@H]2Nc2ccncc2F)cc1 |
| InChI | InChI=1S/C17H17FN2O4/c18-13-9-19-7-5-14(13)20-15-10-23-8-6-16(15)24-12-3-1-11(2-4-12)17(21)22/h1-5,7,9,15-16H,6,8,10H2,(H,19,20)(H,21,22)/t15-,16-/m1/s1 |
| InChIKey | UPSXECFXSOYJKA-HZPDHXFCSA-N |
| XLogP | 2.57 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |