C15H16FN3O2 — CID 91765729
3-fluoro-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyridin-4-amine (PubChem CID 91765729) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 3-fluoro-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyridin-4-amine.
| Compound Name | 3-fluoro-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 91765729 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-fluoro-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyridin-4-amine |
| SMILES | Fc1cnccc1N[C@@H]1COCC[C@H]1Oc1ccccn1 |
| InChI | InChI=1S/C15H16FN3O2/c16-11-9-17-7-4-12(11)19-13-10-20-8-5-14(13)21-15-3-1-2-6-18-15/h1-4,6-7,9,13-14H,5,8,10H2,(H,17,19)/t13-,14-/m1/s1 |
| InChIKey | UMKLQSDFPWBMRG-ZIAGYGMSSA-N |
| XLogP | 2.26 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |