C17H20N4O2 — CID 91771738
6-cyclopropyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyrimidin-4-amine (PubChem CID 91771738) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-cyclopropyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91771738 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-cyclopropyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]pyrimidin-4-amine |
| SMILES | c1ccc(O[C@@H]2CCOC[C@H]2Nc2cc(C3CC3)ncn2)nc1 |
| InChI | InChI=1S/C17H20N4O2/c1-2-7-18-17(3-1)23-15-6-8-22-10-14(15)21-16-9-13(12-4-5-12)19-11-20-16/h1-3,7,9,11-12,14-15H,4-6,8,10H2,(H,19,20,21)/t14-,15-/m1/s1 |
| InChIKey | LGNQXPQELLNFSQ-HUUCEWRRSA-N |
| XLogP | 2.40 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |