C15H16ClN3O2 — CID 91773034
3-chloro-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]pyridin-2-amine (PubChem CID 91773034) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is 3-chloro-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]pyridin-2-amine.
| Compound Name | 3-chloro-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 91773034 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-chloro-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]pyridin-2-amine |
| SMILES | Clc1cccnc1N[C@@H]1CCOC[C@H]1Oc1ccccn1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-11-4-3-8-18-15(11)19-12-6-9-20-10-13(12)21-14-5-1-2-7-17-14/h1-5,7-8,12-13H,6,9-10H2,(H,18,19)/t12-,13-/m1/s1 |
| InChIKey | NTVXJYGKZRDCPL-CHWSQXEVSA-N |
| XLogP | 2.78 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |