About 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide
2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide (PubChem CID 91790443) has the molecular formula C16H24N4O3
and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide |
| PubChem CID | 91790443 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H]2COCC[C@@H]2OCC2CCC2)nc(N)n1 |
| InChI | InChI=1S/C16H24N4O3/c1-10-7-12(20-16(17)18-10)15(21)19-13-9-22-6-5-14(13)23-8-11-3-2-4-11/h7,11,13-14H,2-6,8-9H2,1H3,(H,19,21)(H2,17,18,20)/t13-,14+/m1/s1 |
| InChIKey | DMFJUDXWYUAMPI-KGLIPLIRSA-N |
| XLogP | 1.07 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide?
The IUPAC name of 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide (CID 91790443) is 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide.
What is the SMILES notation for 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide?
The canonical SMILES for 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide is Cc1cc(C(=O)N[C@@H]2COCC[C@@H]2OCC2CCC2)nc(N)n1.
What is the InChIKey of 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide?
The InChIKey is DMFJUDXWYUAMPI-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H24N4O3/c1-10-7-12(20-16(17)18-10)15(21)19-13-9-22-6-5-14(13)23-8-11-3-2-4-11/h7,11,13-14H,2-6,8-9H2,1H3,(H,19,21)(H2,17,18,20)/t13-,14+/m1/s1.
What are the key properties of 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide?
2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide has a molecular weight of 320.39 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-6-methylpyrimidine-4-carboxamide is sourced from PubChem (CID 91790443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).