C16H19BrFNO3 — CID 120543696
1-[[[2-(3-bromo-4-fluorophenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120543696) has the molecular formula C16H19BrFNO3 and a molecular weight of 372.23 g/mol. Its IUPAC name is 1-[[[2-(3-bromo-4-fluorophenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[[2-(3-bromo-4-fluorophenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120543696 |
| Molecular Formula | C16H19BrFNO3 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 1-[[[2-(3-bromo-4-fluorophenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Cc1ccc(F)c(Br)c1)NCC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C16H19BrFNO3/c17-12-8-11(4-5-13(12)18)9-14(20)19-10-16(15(21)22)6-2-1-3-7-16/h4-5,8H,1-3,6-7,9-10H2,(H,19,20)(H,21,22) |
| InChIKey | UIPKCAYFYQZFDT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |