C14H16BrF2NO — CID 114166834
2-(3-bromo-2,6-difluorophenyl)-1-(3-methylpiperidin-3-yl)ethanone (PubChem CID 114166834) has the molecular formula C14H16BrF2NO and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(3-methylpiperidin-3-yl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-methylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 114166834 |
| Molecular Formula | C14H16BrF2NO |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-methylpiperidin-3-yl)ethanone |
| SMILES | CC1(C(=O)Cc2c(F)ccc(Br)c2F)CCCNC1 |
| InChI | InChI=1S/C14H16BrF2NO/c1-14(5-2-6-18-8-14)12(19)7-9-11(16)4-3-10(15)13(9)17/h3-4,18H,2,5-8H2,1H3 |
| InChIKey | UTZQKYJCVGIKLZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|