C13H15BrCl2N2O — CID 107790194
N-(4-bromo-2,3-dichlorophenyl)-3-methylpiperidine-3-carboxamide (PubChem CID 107790194) has the molecular formula C13H15BrCl2N2O and a molecular weight of 366.09 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-3-methylpiperidine-3-carboxamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-3-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 107790194 |
| Molecular Formula | C13H15BrCl2N2O |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-3-methylpiperidine-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(Br)c(Cl)c2Cl)CCCNC1 |
| InChI | InChI=1S/C13H15BrCl2N2O/c1-13(5-2-6-17-7-13)12(19)18-9-4-3-8(14)10(15)11(9)16/h3-4,17H,2,5-7H2,1H3,(H,18,19) |
| InChIKey | PTZHSOYBTOYMCP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|