C14H17ClN2O3 — CID 63131872
4-chloro-2-[(3-methylpiperidine-3-carbonyl)amino]benzoic acid (PubChem CID 63131872) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 4-chloro-2-[(3-methylpiperidine-3-carbonyl)amino]benzoic acid.
| Compound Name | 4-chloro-2-[(3-methylpiperidine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63131872 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-chloro-2-[(3-methylpiperidine-3-carbonyl)amino]benzoic acid |
| SMILES | CC1(C(=O)Nc2cc(Cl)ccc2C(=O)O)CCCNC1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-14(5-2-6-16-8-14)13(20)17-11-7-9(15)3-4-10(11)12(18)19/h3-4,7,16H,2,5-6,8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | NUQDGBNYNNNSIP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |