C17H22BrF2N — CID 106271386
N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexyl]methyl]cyclopropanamine (PubChem CID 106271386) has the molecular formula C17H22BrF2N and a molecular weight of 358.27 g/mol. Its IUPAC name is N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexyl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106271386 |
| Molecular Formula | C17H22BrF2N |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[[1-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Br)c(F)c1CC1(CNC2CC2)CCCCC1 |
| InChI | InChI=1S/C17H22BrF2N/c18-14-6-7-15(19)13(16(14)20)10-17(8-2-1-3-9-17)11-21-12-4-5-12/h6-7,12,21H,1-5,8-11H2 |
| InChIKey | ZSSHPKASDJDNTQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|