C12H11BrF2O2 — CID 106264797
1-[(3-bromo-2,6-difluorophenyl)methyl]cyclobutane-1-carboxylic acid (PubChem CID 106264797) has the molecular formula C12H11BrF2O2 and a molecular weight of 305.12 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 106264797 |
| Molecular Formula | C12H11BrF2O2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2c(F)ccc(Br)c2F)CCC1 |
| InChI | InChI=1S/C12H11BrF2O2/c13-8-2-3-9(14)7(10(8)15)6-12(11(16)17)4-1-5-12/h2-3H,1,4-6H2,(H,16,17) |
| InChIKey | SLEUQDFITFCJKY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|