C11H11BrF2O3S — CID 114165872
3-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dioxothiolan-3-ol (PubChem CID 114165872) has the molecular formula C11H11BrF2O3S and a molecular weight of 341.17 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dioxothiolan-3-ol.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 114165872 |
| Molecular Formula | C11H11BrF2O3S |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CCC(O)(Cc2c(F)ccc(Br)c2F)C1 |
| InChI | InChI=1S/C11H11BrF2O3S/c12-8-1-2-9(13)7(10(8)14)5-11(15)3-4-18(16,17)6-11/h1-2,15H,3-6H2 |
| InChIKey | MMSFAWYNSARELV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|