C11H12BrFO3S — CID 65146090
3-[(5-bromo-2-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol (PubChem CID 65146090) has the molecular formula C11H12BrFO3S and a molecular weight of 323.18 g/mol. Its IUPAC name is 3-[(5-bromo-2-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol.
| Compound Name | 3-[(5-bromo-2-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 65146090 |
| Molecular Formula | C11H12BrFO3S |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 3-[(5-bromo-2-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CCC(O)(Cc2cc(Br)ccc2F)C1 |
| InChI | InChI=1S/C11H12BrFO3S/c12-9-1-2-10(13)8(5-9)6-11(14)3-4-17(15,16)7-11/h1-2,5,14H,3-4,6-7H2 |
| InChIKey | SKAHVGJHWQANSG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |