C16H22BrF2NO — CID 106265398
4-[(3-bromo-2,6-difluorophenyl)methyl]-1-propylazepan-4-ol (PubChem CID 106265398) has the molecular formula C16H22BrF2NO and a molecular weight of 362.26 g/mol. Its IUPAC name is 4-[(3-bromo-2,6-difluorophenyl)methyl]-1-propylazepan-4-ol.
| Compound Name | 4-[(3-bromo-2,6-difluorophenyl)methyl]-1-propylazepan-4-ol |
|---|---|
| PubChem CID | 106265398 |
| Molecular Formula | C16H22BrF2NO |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-[(3-bromo-2,6-difluorophenyl)methyl]-1-propylazepan-4-ol |
| SMILES | CCCN1CCCC(O)(Cc2c(F)ccc(Br)c2F)CC1 |
| InChI | InChI=1S/C16H22BrF2NO/c1-2-8-20-9-3-6-16(21,7-10-20)11-12-14(18)5-4-13(17)15(12)19/h4-5,21H,2-3,6-11H2,1H3 |
| InChIKey | RFRPEVNWCXOCOK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|