C17H24BrF2N — CID 106273588
[1-[(3-bromo-2,6-difluorophenyl)methyl]-4-propan-2-ylcyclohexyl]methanamine (PubChem CID 106273588) has the molecular formula C17H24BrF2N and a molecular weight of 360.29 g/mol. Its IUPAC name is [1-[(3-bromo-2,6-difluorophenyl)methyl]-4-propan-2-ylcyclohexyl]methanamine.
| Compound Name | [1-[(3-bromo-2,6-difluorophenyl)methyl]-4-propan-2-ylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 106273588 |
| Molecular Formula | C17H24BrF2N |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [1-[(3-bromo-2,6-difluorophenyl)methyl]-4-propan-2-ylcyclohexyl]methanamine |
| SMILES | CC(C)C1CCC(CN)(Cc2c(F)ccc(Br)c2F)CC1 |
| InChI | InChI=1S/C17H24BrF2N/c1-11(2)12-5-7-17(10-21,8-6-12)9-13-15(19)4-3-14(18)16(13)20/h3-4,11-12H,5-10,21H2,1-2H3 |
| InChIKey | MEKIBMPMWRVSNG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|