C8H15ClF3NO — CID 75481559
1-(aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol;hydrochloride (PubChem CID 75481559) has the molecular formula C8H15ClF3NO and a molecular weight of 233.66 g/mol. Its IUPAC name is 1-(aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-(aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 75481559 |
| Molecular Formula | C8H15ClF3NO |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-(aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.NCC1(O)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3NO.ClH/c9-8(10,11)6-2-1-3-7(13,4-6)5-12;/h6,13H,1-5,12H2;1H |
| InChIKey | QTYFWXMVARDHMF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |