C9H14F3N — CID 124526779
(2R,3R,7S)-7-(trifluoromethyl)spiro[2.5]octan-2-amine (PubChem CID 124526779) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is (2R,3R,7S)-7-(trifluoromethyl)spiro[2.5]octan-2-amine.
| Compound Name | (2R,3R,7S)-7-(trifluoromethyl)spiro[2.5]octan-2-amine |
|---|---|
| PubChem CID | 124526779 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2R,3R,7S)-7-(trifluoromethyl)spiro[2.5]octan-2-amine |
| SMILES | N[C@@H]1C[C@]12CCC[C@H](C(F)(F)F)C2 |
| InChI | InChI=1S/C9H14F3N/c10-9(11,12)6-2-1-3-8(4-6)5-7(8)13/h6-7H,1-5,13H2/t6-,7+,8+/m0/s1 |
| InChIKey | GNSFSQRUOKSVSP-XLPZGREQSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |