C10H17F3N2 — CID 155904281
(2S,4S)-2-(trifluoromethyl)-8-azaspiro[4.5]decan-4-amine (PubChem CID 155904281) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is (2S,4S)-2-(trifluoromethyl)-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (2S,4S)-2-(trifluoromethyl)-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 155904281 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2S,4S)-2-(trifluoromethyl)-8-azaspiro[4.5]decan-4-amine |
| SMILES | N[C@H]1C[C@@H](C(F)(F)F)CC12CCNCC2 |
| InChI | InChI=1S/C10H17F3N2/c11-10(12,13)7-5-8(14)9(6-7)1-3-15-4-2-9/h7-8,15H,1-6,14H2/t7-,8+/m1/s1 |
| InChIKey | GJMREZOAPBMZLA-SFYZADRCSA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |