C14H13ClF4O2 — CID 142680010
3-[1-(2-chloro-5-fluorophenyl)cyclobutyl]-4,4,4-trifluoro-3-hydroxybutanal (PubChem CID 142680010) has the molecular formula C14H13ClF4O2 and a molecular weight of 324.70 g/mol. Its IUPAC name is 3-[1-(2-chloro-5-fluorophenyl)cyclobutyl]-4,4,4-trifluoro-3-hydroxybutanal.
| Compound Name | 3-[1-(2-chloro-5-fluorophenyl)cyclobutyl]-4,4,4-trifluoro-3-hydroxybutanal |
|---|---|
| PubChem CID | 142680010 |
| Molecular Formula | C14H13ClF4O2 |
| Molecular Weight | 324.70 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[1-(2-chloro-5-fluorophenyl)cyclobutyl]-4,4,4-trifluoro-3-hydroxybutanal |
| SMILES | O=CCC(O)(C(F)(F)F)C1(c2cc(F)ccc2Cl)CCC1 |
| InChI | InChI=1S/C14H13ClF4O2/c15-11-3-2-9(16)8-10(11)12(4-1-5-12)13(21,6-7-20)14(17,18)19/h2-3,7-8,21H,1,4-6H2 |
| InChIKey | YHVYFSGFRNPKOQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|