C18H18ClFO — CID 105393716
1-(2-chloro-5-fluorophenyl)-2-phenylcyclohexan-1-ol (PubChem CID 105393716) has the molecular formula C18H18ClFO and a molecular weight of 304.79 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-2-phenylcyclohexan-1-ol.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-2-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 105393716 |
| Molecular Formula | C18H18ClFO |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-2-phenylcyclohexan-1-ol |
| SMILES | OC1(c2cc(F)ccc2Cl)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C18H18ClFO/c19-17-10-9-14(20)12-16(17)18(21)11-5-4-8-15(18)13-6-2-1-3-7-13/h1-3,6-7,9-10,12,15,21H,4-5,8,11H2 |
| InChIKey | JSLGGNGDMQAHSJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |