C12H14BrClO2 — CID 106823811
1-[(4-bromo-2-chlorophenyl)methyl]-3-methoxycyclobutan-1-ol (PubChem CID 106823811) has the molecular formula C12H14BrClO2 and a molecular weight of 305.60 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenyl)methyl]-3-methoxycyclobutan-1-ol.
| Compound Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-methoxycyclobutan-1-ol |
|---|---|
| PubChem CID | 106823811 |
| Molecular Formula | C12H14BrClO2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-methoxycyclobutan-1-ol |
| SMILES | COC1CC(O)(Cc2ccc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C12H14BrClO2/c1-16-10-6-12(15,7-10)5-8-2-3-9(13)4-11(8)14/h2-4,10,15H,5-7H2,1H3 |
| InChIKey | GRRQAHAGHVDHLT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |