C15H21BrClN — CID 113471460
N-[[1-[(4-bromo-2-chlorophenyl)methyl]cyclobutyl]methyl]propan-2-amine (PubChem CID 113471460) has the molecular formula C15H21BrClN and a molecular weight of 330.70 g/mol. Its IUPAC name is N-[[1-[(4-bromo-2-chlorophenyl)methyl]cyclobutyl]methyl]propan-2-amine.
| Compound Name | N-[[1-[(4-bromo-2-chlorophenyl)methyl]cyclobutyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 113471460 |
| Molecular Formula | C15H21BrClN |
| Molecular Weight | 330.70 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-[[1-[(4-bromo-2-chlorophenyl)methyl]cyclobutyl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(Cc2ccc(Br)cc2Cl)CCC1 |
| InChI | InChI=1S/C15H21BrClN/c1-11(2)18-10-15(6-3-7-15)9-12-4-5-13(16)8-14(12)17/h4-5,8,11,18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | SVTNEKMAYPYAQF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |