C17H26ClN — CID 106869506
N-[[1-[(2-chloro-4-methylphenyl)methyl]cyclopentyl]methyl]propan-1-amine (PubChem CID 106869506) has the molecular formula C17H26ClN and a molecular weight of 279.86 g/mol. Its IUPAC name is N-[[1-[(2-chloro-4-methylphenyl)methyl]cyclopentyl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(2-chloro-4-methylphenyl)methyl]cyclopentyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106869506 |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.86 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-[[1-[(2-chloro-4-methylphenyl)methyl]cyclopentyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(Cc2ccc(C)cc2Cl)CCCC1 |
| InChI | InChI=1S/C17H26ClN/c1-3-10-19-13-17(8-4-5-9-17)12-15-7-6-14(2)11-16(15)18/h6-7,11,19H,3-5,8-10,12-13H2,1-2H3 |
| InChIKey | JQKCNVFODVMBRF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|