C18H26O2S — CID 171963888
3-[(4-tert-butylphenyl)methyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171963888) has the molecular formula C18H26O2S and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[(4-tert-butylphenyl)methyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171963888 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)(C)c1ccc(CC2(O)CC3CCC(C2)S3=O)cc1 |
| InChI | InChI=1S/C18H26O2S/c1-17(2,3)14-6-4-13(5-7-14)10-18(19)11-15-8-9-16(12-18)21(15)20/h4-7,15-16,19H,8-12H2,1-3H3 |
| InChIKey | JALVGZYDXFGACS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |