C20H29N — CID 65424072
1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexane-1-carbonitrile (PubChem CID 65424072) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexane-1-carbonitrile.
| Compound Name | 1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65424072 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexane-1-carbonitrile |
| SMILES | CCCC1CCC(C#N)(Cc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H29N/c1-4-5-17-10-12-20(15-21,13-11-17)14-18-6-8-19(9-7-18)16(2)3/h6-9,16-17H,4-5,10-14H2,1-3H3 |
| InChIKey | QCUKAYXUMWWPLU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |