C16H28N2O — CID 62126069
4-tert-butyl-1-[(1-ethylpyrazol-4-yl)methyl]cyclohexan-1-ol (PubChem CID 62126069) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 4-tert-butyl-1-[(1-ethylpyrazol-4-yl)methyl]cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1-[(1-ethylpyrazol-4-yl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 62126069 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 4-tert-butyl-1-[(1-ethylpyrazol-4-yl)methyl]cyclohexan-1-ol |
| SMILES | CCn1cc(CC2(O)CCC(C(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C16H28N2O/c1-5-18-12-13(11-17-18)10-16(19)8-6-14(7-9-16)15(2,3)4/h11-12,14,19H,5-10H2,1-4H3 |
| InChIKey | UOMXLMCCJMELJA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |