C18H32N2O — CID 65094517
4-tert-butyl-1-[(1-propan-2-ylpyrazol-3-yl)methyl]cycloheptan-1-ol (PubChem CID 65094517) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 4-tert-butyl-1-[(1-propan-2-ylpyrazol-3-yl)methyl]cycloheptan-1-ol.
| Compound Name | 4-tert-butyl-1-[(1-propan-2-ylpyrazol-3-yl)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 65094517 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 4-tert-butyl-1-[(1-propan-2-ylpyrazol-3-yl)methyl]cycloheptan-1-ol |
| SMILES | CC(C)n1ccc(CC2(O)CCCC(C(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C18H32N2O/c1-14(2)20-12-9-16(19-20)13-18(21)10-6-7-15(8-11-18)17(3,4)5/h9,12,14-15,21H,6-8,10-11,13H2,1-5H3 |
| InChIKey | KKGOSTRULRABQM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |