C18H27BrO — CID 65094519
1-[(3-bromophenyl)methyl]-4-tert-butylcycloheptan-1-ol (PubChem CID 65094519) has the molecular formula C18H27BrO and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-4-tert-butylcycloheptan-1-ol.
| Compound Name | 1-[(3-bromophenyl)methyl]-4-tert-butylcycloheptan-1-ol |
|---|---|
| PubChem CID | 65094519 |
| Molecular Formula | C18H27BrO |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-4-tert-butylcycloheptan-1-ol |
| SMILES | CC(C)(C)C1CCCC(O)(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H27BrO/c1-17(2,3)15-7-5-10-18(20,11-9-15)13-14-6-4-8-16(19)12-14/h4,6,8,12,15,20H,5,7,9-11,13H2,1-3H3 |
| InChIKey | WLGQWFSXVJHPMR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |