C13H15BrO — CID 79331771
6-[(3-bromophenyl)methyl]bicyclo[3.1.0]hexan-6-ol (PubChem CID 79331771) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is 6-[(3-bromophenyl)methyl]bicyclo[3.1.0]hexan-6-ol.
| Compound Name | 6-[(3-bromophenyl)methyl]bicyclo[3.1.0]hexan-6-ol |
|---|---|
| PubChem CID | 79331771 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 6-[(3-bromophenyl)methyl]bicyclo[3.1.0]hexan-6-ol |
| SMILES | OC1(Cc2cccc(Br)c2)C2CCCC21 |
| InChI | InChI=1S/C13H15BrO/c14-10-4-1-3-9(7-10)8-13(15)11-5-2-6-12(11)13/h1,3-4,7,11-12,15H,2,5-6,8H2 |
| InChIKey | ORUXTSPFPGQKDJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |