C9H14N2O — CID 82870094
1-[(1-methylpyrazol-3-yl)methyl]cyclobutan-1-ol (PubChem CID 82870094) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-[(1-methylpyrazol-3-yl)methyl]cyclobutan-1-ol.
| Compound Name | 1-[(1-methylpyrazol-3-yl)methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 82870094 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-[(1-methylpyrazol-3-yl)methyl]cyclobutan-1-ol |
| SMILES | Cn1ccc(CC2(O)CCC2)n1 |
| InChI | InChI=1S/C9H14N2O/c1-11-6-3-8(10-11)7-9(12)4-2-5-9/h3,6,12H,2,4-5,7H2,1H3 |
| InChIKey | SQIQBRXPHDWNHL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |