C9H14N2O3S — CID 82869427
3-[(1-methylpyrazol-3-yl)methyl]-1,1-dioxothiolan-3-ol (PubChem CID 82869427) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-[(1-methylpyrazol-3-yl)methyl]-1,1-dioxothiolan-3-ol.
| Compound Name | 3-[(1-methylpyrazol-3-yl)methyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 82869427 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-[(1-methylpyrazol-3-yl)methyl]-1,1-dioxothiolan-3-ol |
| SMILES | Cn1ccc(CC2(O)CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C9H14N2O3S/c1-11-4-2-8(10-11)6-9(12)3-5-15(13,14)7-9/h2,4,12H,3,5-7H2,1H3 |
| InChIKey | HKQRPPZQRCBLLD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |