C14H16N2O — CID 82870413
2-[(1-methylpyrazol-3-yl)methyl]-1,3-dihydroinden-2-ol (PubChem CID 82870413) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-3-yl)methyl]-1,3-dihydroinden-2-ol.
| Compound Name | 2-[(1-methylpyrazol-3-yl)methyl]-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 82870413 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[(1-methylpyrazol-3-yl)methyl]-1,3-dihydroinden-2-ol |
| SMILES | Cn1ccc(CC2(O)Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C14H16N2O/c1-16-7-6-13(15-16)10-14(17)8-11-4-2-3-5-12(11)9-14/h2-7,17H,8-10H2,1H3 |
| InChIKey | PKKQCHOEGYKIIH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |