C11H12ClFO — CID 114852385
1-[(4-chloro-2-fluorophenyl)methyl]cyclobutan-1-ol (PubChem CID 114852385) has the molecular formula C11H12ClFO and a molecular weight of 214.67 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]cyclobutan-1-ol.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 114852385 |
| Molecular Formula | C11H12ClFO |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]cyclobutan-1-ol |
| SMILES | OC1(Cc2ccc(Cl)cc2F)CCC1 |
| InChI | InChI=1S/C11H12ClFO/c12-9-3-2-8(10(13)6-9)7-11(14)4-1-5-11/h2-3,6,14H,1,4-5,7H2 |
| InChIKey | GFJUBJJTJHZGGA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |