C13H14ClFO — CID 114852720
1-[(4-chloro-2-fluorophenyl)methyl]cyclohex-2-en-1-ol (PubChem CID 114852720) has the molecular formula C13H14ClFO and a molecular weight of 240.71 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]cyclohex-2-en-1-ol.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 114852720 |
| Molecular Formula | C13H14ClFO |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]cyclohex-2-en-1-ol |
| SMILES | OC1(Cc2ccc(Cl)cc2F)C=CCCC1 |
| InChI | InChI=1S/C13H14ClFO/c14-11-5-4-10(12(15)8-11)9-13(16)6-2-1-3-7-13/h2,4-6,8,16H,1,3,7,9H2 |
| InChIKey | FABAPAKYDUAMAQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|