C15H20Cl2O — CID 65153745
1-[(2,6-dichlorophenyl)methyl]-2,3-dimethylcyclohexan-1-ol (PubChem CID 65153745) has the molecular formula C15H20Cl2O and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-2,3-dimethylcyclohexan-1-ol.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-2,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65153745 |
| Molecular Formula | C15H20Cl2O |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-2,3-dimethylcyclohexan-1-ol |
| SMILES | CC1CCCC(O)(Cc2c(Cl)cccc2Cl)C1C |
| InChI | InChI=1S/C15H20Cl2O/c1-10-5-4-8-15(18,11(10)2)9-12-13(16)6-3-7-14(12)17/h3,6-7,10-11,18H,4-5,8-9H2,1-2H3 |
| InChIKey | VDRKTFUDBIBIBR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |