C13H17Cl2N — CID 63277735
N-[(2,6-dichlorophenyl)methyl]-2-methylcyclopentan-1-amine (PubChem CID 63277735) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-2-methylcyclopentan-1-amine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-2-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 63277735 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-2-methylcyclopentan-1-amine |
| SMILES | CC1CCCC1NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H17Cl2N/c1-9-4-2-7-13(9)16-8-10-11(14)5-3-6-12(10)15/h3,5-6,9,13,16H,2,4,7-8H2,1H3 |
| InChIKey | WVOXKILOPBXPNT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |