C13H18ClNO2 — CID 78960343
3-chloro-2-[[(2-methoxycyclopentyl)amino]methyl]phenol (PubChem CID 78960343) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is 3-chloro-2-[[(2-methoxycyclopentyl)amino]methyl]phenol.
| Compound Name | 3-chloro-2-[[(2-methoxycyclopentyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 78960343 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-chloro-2-[[(2-methoxycyclopentyl)amino]methyl]phenol |
| SMILES | COC1CCCC1NCc1c(O)cccc1Cl |
| InChI | InChI=1S/C13H18ClNO2/c1-17-13-7-3-5-11(13)15-8-9-10(14)4-2-6-12(9)16/h2,4,6,11,13,15-16H,3,5,7-8H2,1H3 |
| InChIKey | FBHIKZDNZRQQMZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|