C12H17NO3S — CID 103248534
3-[[(2-methoxycyclopentyl)amino]methyl]thiophene-2-carboxylic acid (PubChem CID 103248534) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-[[(2-methoxycyclopentyl)amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[(2-methoxycyclopentyl)amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103248534 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-[[(2-methoxycyclopentyl)amino]methyl]thiophene-2-carboxylic acid |
| SMILES | COC1CCCC1NCc1ccsc1C(=O)O |
| InChI | InChI=1S/C12H17NO3S/c1-16-10-4-2-3-9(10)13-7-8-5-6-17-11(8)12(14)15/h5-6,9-10,13H,2-4,7H2,1H3,(H,14,15) |
| InChIKey | WRFYVTSMZNNRMY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |