C13H16Cl2O3S — CID 65153658
1-[(2,6-dichlorophenyl)methyl]-2-methylsulfonylcyclopentan-1-ol (PubChem CID 65153658) has the molecular formula C13H16Cl2O3S and a molecular weight of 323.24 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-2-methylsulfonylcyclopentan-1-ol.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-2-methylsulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 65153658 |
| Molecular Formula | C13H16Cl2O3S |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-2-methylsulfonylcyclopentan-1-ol |
| SMILES | CS(=O)(=O)C1CCCC1(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2O3S/c1-19(17,18)12-6-3-7-13(12,16)8-9-10(14)4-2-5-11(9)15/h2,4-5,12,16H,3,6-8H2,1H3 |
| InChIKey | YMAHKIGODZQVSJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |