About 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol
2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol (PubChem CID 65049715) has the molecular formula C9H15F3O3S
and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol |
| PubChem CID | 65049715 |
| Molecular Formula | C9H15F3O3S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol |
| SMILES | CS(=O)(=O)C1CCCC1(O)CCC(F)(F)F |
| InChI | InChI=1S/C9H15F3O3S/c1-16(14,15)7-3-2-4-8(7,13)5-6-9(10,11)12/h7,13H,2-6H2,1H3 |
| InChIKey | DLRLXUOAEJICJK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol?
The IUPAC name of 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol (CID 65049715) is 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol.
What is the SMILES notation for 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol?
The canonical SMILES for 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol is CS(=O)(=O)C1CCCC1(O)CCC(F)(F)F.
What is the InChIKey of 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol?
The InChIKey is DLRLXUOAEJICJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O3S/c1-16(14,15)7-3-2-4-8(7,13)5-6-9(10,11)12/h7,13H,2-6H2,1H3.
What are the key properties of 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol?
2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol has a molecular weight of 260.28 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-1-(3,3,3-trifluoropropyl)cyclopentan-1-ol is sourced from PubChem (CID 65049715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).