C11H15ClO3S2 — CID 65154137
1-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol (PubChem CID 65154137) has the molecular formula C11H15ClO3S2 and a molecular weight of 294.82 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 65154137 |
| Molecular Formula | C11H15ClO3S2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol |
| SMILES | CS(=O)(=O)C1CCCC1(O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H15ClO3S2/c1-17(14,15)9-3-2-6-11(9,13)7-8-4-5-10(12)16-8/h4-5,9,13H,2-3,6-7H2,1H3 |
| InChIKey | JEZJSSCLSCIZAN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |