C11H15BrO3S2 — CID 65154190
1-[(4-bromothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol (PubChem CID 65154190) has the molecular formula C11H15BrO3S2 and a molecular weight of 339.28 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 65154190 |
| Molecular Formula | C11H15BrO3S2 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methylsulfonylcyclopentan-1-ol |
| SMILES | CS(=O)(=O)C1CCCC1(O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H15BrO3S2/c1-17(14,15)10-3-2-4-11(10,13)6-9-5-8(12)7-16-9/h5,7,10,13H,2-4,6H2,1H3 |
| InChIKey | NTERFGUMSXIREC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |