C16H25BrOS — CID 65151469
1-[(4-bromothiophen-2-yl)methyl]-4-tert-butylcycloheptan-1-ol (PubChem CID 65151469) has the molecular formula C16H25BrOS and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-4-tert-butylcycloheptan-1-ol.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-4-tert-butylcycloheptan-1-ol |
|---|---|
| PubChem CID | 65151469 |
| Molecular Formula | C16H25BrOS |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-4-tert-butylcycloheptan-1-ol |
| SMILES | CC(C)(C)C1CCCC(O)(Cc2cc(Br)cs2)CC1 |
| InChI | InChI=1S/C16H25BrOS/c1-15(2,3)12-5-4-7-16(18,8-6-12)10-14-9-13(17)11-19-14/h9,11-12,18H,4-8,10H2,1-3H3 |
| InChIKey | XLJQPWJVNVUHEO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |