C20H32O — CID 66024369
[4-tert-butyl-1-(3-phenylpropyl)cyclohexyl]methanol (PubChem CID 66024369) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is [4-tert-butyl-1-(3-phenylpropyl)cyclohexyl]methanol.
| Compound Name | [4-tert-butyl-1-(3-phenylpropyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 66024369 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | [4-tert-butyl-1-(3-phenylpropyl)cyclohexyl]methanol |
| SMILES | CC(C)(C)C1CCC(CO)(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32O/c1-19(2,3)18-11-14-20(16-21,15-12-18)13-7-10-17-8-5-4-6-9-17/h4-6,8-9,18,21H,7,10-16H2,1-3H3 |
| InChIKey | KISZAXVACYCORA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |