C26H35O8P — CID 177089316
[2,2-dimethylpropanoyloxymethoxy-[(4-phenylmethoxyphenyl)methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 177089316) has the molecular formula C26H35O8P and a molecular weight of 506.53 g/mol. Its IUPAC name is [2,2-dimethylpropanoyloxymethoxy-[(4-phenylmethoxyphenyl)methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2,2-dimethylpropanoyloxymethoxy-[(4-phenylmethoxyphenyl)methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177089316 |
| Molecular Formula | C26H35O8P |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [2,2-dimethylpropanoyloxymethoxy-[(4-phenylmethoxyphenyl)methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(Cc1ccc(OCc2ccccc2)cc1)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H35O8P/c1-25(2,3)23(27)31-18-33-35(29,34-19-32-24(28)26(4,5)6)17-21-12-14-22(15-13-21)30-16-20-10-8-7-9-11-20/h7-15H,16-19H2,1-6H3 |
| InChIKey | QNSJETAPZPFOPK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|